Introduction：Basic information about CAS 152491-85-5|(r)-(+)-n-(tert-butoxycarbonyl)-o-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (r)-(+)-n-(tert-butoxycarbonyl)-o- |
|---|
| CAS Number | 152491-85-5 | Molecular Weight | 305.48600 |
|---|
| Density | 0.979g/cm3 | Boiling Point | 377.301ºC at 760 mmHg |
|---|
| Molecular Formula | C14H31NO4Si | Melting Point | 32-37ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | >230 °F |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | tert-butyl N-[(2R)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxypropan-2-yl]carbamate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.979g/cm3 |
|---|
| Boiling Point | 377.301ºC at 760 mmHg |
|---|
| Melting Point | 32-37ºC(lit.) |
|---|
| Molecular Formula | C14H31NO4Si |
|---|
| Molecular Weight | 305.48600 |
|---|
| Flash Point | >230 °F |
|---|
| Exact Mass | 305.20200 |
|---|
| PSA | 71.28000 |
|---|
| LogP | 3.09820 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.452 |
|---|
| InChIKey | OKOFEVZCVGPZCQ-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CO)CO[Si](C)(C)C(C)(C)C |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| tert-butyl N-[(1R)-2-(tert-butyldimethylsiloxy)-1-(hydroxymethyl)ethyl]carbamate |
| N-Boc-serin-(O-t-butyldimethylsilyl)-ol |
| O-t-butyldimethylsilyl-N-[(1,1-dimethylethoxy)carbonyl]-L-serinol |
| MFCD03093881 |
| (R)-(+)-N-(tert-Butoxycarbonyl)-O-(tert-butyldimethylsilyl)serinol |
| (R)-[1-(tert-butyl-dimethyl-silanyloxymethyl)-2-hydroxy-ethyl]-carbamic acid tert-butyl ester |
| 1,1-dimethylethyl [(1R)-2-{[(1,1-dimethylethyl)(dimethyl)silyl]oxy}-1-(hydroxymethyl)ethyl]carbamate |
| tert-butyl (R)-1-(tert-butyldimethylsilyloxy)-3-hydroxypropan-2-yl carbamate |
| (R)-tert-butyl 1-(tert-butyldimethylsilyloxy)-3-hydroxypropan-2-ylcarbamate |
