Introduction:Basic information about CAS 570-08-1|Ethyl acetomalonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl acetomalonate |
|---|
| CAS Number | 570-08-1 | Molecular Weight | 202.204 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 232.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H14O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 99.0±21.8 °C |
|---|
Names
| Name | Diethyl 2-acetylmalonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 232.0±0.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H14O5 |
|---|
| Molecular Weight | 202.204 |
|---|
| Flash Point | 99.0±21.8 °C |
|---|
| Exact Mass | 202.084122 |
|---|
| PSA | 69.67000 |
|---|
| LogP | 1.98 |
|---|
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
|---|
| Index of Refraction | 1.434 |
|---|
| InChIKey | SQAUUQRBOCJRCW-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C(C)=O)C(=O)OCC |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Butanoic acid, (ethoxycarbonyl)-3-oxo-, ethyl ester |
| Acetonedicarboxylic acid diethyl ester |
| Acetonedicarboxylic acid, diethyl ester |
| Propanedioic acid, 2-acetyl-, diethyl ester |
| Ethyl acetomalonate |
| Ethyl acetonedicarboxylate |
| Diethyl acetonedicarboxylate (VAN) |
| diethyl 2-acetylpropanedioate |
| Malonic acid, acetyl-, diethyl ester |
| Diethyl acetylmalonate |
| Propanedioic acid, acetyl-, diethyl ester |
| Diethyl acetonedicarboxylate |
| MFCD00026876 |