Introduction:Basic information about CAS 2040-01-9|2',3',4',5',6'-pentamethylacetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2',3',4',5',6'-pentamethylacetophenone |
|---|
| CAS Number | 2040-01-9 | Molecular Weight | 190.28100 |
|---|
| Density | 0.94g/cm3 | Boiling Point | 311.4ºC at 760mmHg |
|---|
| Molecular Formula | C13H18O | Melting Point | 84-86 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 131ºC |
|---|
Names
| Name | 1-(2,3,4,5,6-pentamethylphenyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.94g/cm3 |
|---|
| Boiling Point | 311.4ºC at 760mmHg |
|---|
| Melting Point | 84-86 °C(lit.) |
|---|
| Molecular Formula | C13H18O |
|---|
| Molecular Weight | 190.28100 |
|---|
| Flash Point | 131ºC |
|---|
| Exact Mass | 190.13600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.43120 |
|---|
| Vapour Pressure | 0.000564mmHg at 25°C |
|---|
| Index of Refraction | 1.508 |
|---|
| InChIKey | CTTYWXDVWGKHKJ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1c(C)c(C)c(C)c(C)c1C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2914399090 |
|---|
Customs
| HS Code | 2914399090 |
|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|---|
Synonyms
| Pentamethylacetophenone |
| 1-pentamethylphenyl-ethanone |
| 2′,3′,4′,5′,6′-Pentamethylacetophenone |
| EINECS 218-033-6 |
| 1-Pentamethylphenyl-aethanon |
| 2,3,4,5,6-pentamethylacetophenone |
| MFCD00014986 |
| Acetylpentamethylbenzene |