Introduction:Basic information about CAS 73309-49-6|7-Naphthalenedisulfonic acid, 4-amino-6-[[4-[[[4-[(2,4-dihydroxyphenyl)azo] phenyl] a, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 7-Naphthalenedisulfonic acid, 4-amino-6-[[4-[[[4-[(2,4-dihydroxyphenyl)azo] phenyl] amino] sulfonyl]2 |
|---|
| CAS Number | 73309-49-6 | Molecular Weight | 863.81000 |
|---|
| Density | 1.76g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C34H25N9O13S3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (3Z)-5-amino-3-[[4-[[4-[(2Z)-2-(2-hydroxy-4-oxocyclohexa-2,5-dien-1-ylidene)hydrazinyl]phenyl]sulfamoyl]phenyl]hydrazinylidene]-6-[(4-nitrophenyl)diazenyl]-4-oxonaphthalene-2,7-disulfonic acid |
|---|
Chemical & Physical Properties
| Density | 1.76g/cm3 |
|---|
| Molecular Formula | C34H25N9O13S3 |
|---|
| Molecular Weight | 863.81000 |
|---|
| Exact Mass | 863.07300 |
|---|
| PSA | 379.76000 |
|---|
| LogP | 9.44750 |
|---|
| Index of Refraction | 1.786 |
|---|
| InChIKey | USXMEZVRIJLDML-UHFFFAOYSA-N |
|---|
| SMILES | Nc1c(N=Nc2ccc([N+](=O)[O-])cc2)c(S(=O)(=O)O)cc2cc(S(=O)(=O)O)c(N=Nc3ccc(S(=O)(=O)Nc4ccc(N=Nc5ccc(O)cc5O)cc4)cc3)c(O)c12 |
|---|