Introduction：Basic information about CAS 80118-10-1|1,3-dimethyl-3-butenyl salicylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-dimethyl-3-butenyl salicylate |
|---|
| CAS Number | 80118-10-1 | Molecular Weight | 220.26400 |
|---|
| Density | 1.037g/cm3 | Boiling Point | 319.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 131ºC |
|---|
Names
| Name | 4-methylpent-4-en-2-yl 2-hydroxybenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.037g/cm3 |
|---|
| Boiling Point | 319.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16O3 |
|---|
| Molecular Weight | 220.26400 |
|---|
| Flash Point | 131ºC |
|---|
| Exact Mass | 220.11000 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 2.90370 |
|---|
| Index of Refraction | 1.506 |
|---|
| InChIKey | VBOJHXQVOIZGQO-UHFFFAOYSA-N |
|---|
| SMILES | C=C(C)CC(C)OC(=O)c1ccccc1O |
|---|
Synonyms
| Benzoic acid,2-hydroxy-,1,3-dimethyl-3-buten-1-yl ester |
| EINECS 279-400-4 |
| Benzoic acid,2-hydroxy-,1,3-dimethyl-3-butenyl ester |
| 1,3-Dimethyl-3-butenyl salicylate |
