Introduction：Basic information about CAS 80121-67-1|3-Ethyl-1-adamantanamine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Ethyl-1-adamantanamine hydrochloride |
|---|
| CAS Number | 80121-67-1 | Molecular Weight | 215.76300 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C12H22ClN | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-ethyladamantan-1-amine,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C12H22ClN |
|---|
| Molecular Weight | 215.76300 |
|---|
| Exact Mass | 215.14400 |
|---|
| PSA | 26.02000 |
|---|
| LogP | 4.19640 |
|---|
| InChIKey | SLOLBBCVFZRLLS-UHFFFAOYSA-N |
|---|
| SMILES | CCC12CC3CC(CC(N)(C3)C1)C2.Cl |
|---|
Safety Information
Customs
| HS Code | 2921300090 |
|---|
| Summary | 2921300090 other cyclanic, cyclenic or cyclotherpenic mono- or polyamines, and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 3-ethyladamantan-1-amine hydrochloride |
| 1-aminoadamantane,3-ethyl hydrochloride |
| (3-Ethyl-1-adamantyl)amine hydrochloride |
| 1-Amino-3-ethyladamantane hydrochloride |
