Introduction：Basic information about CAS 85233-16-5|1-Fluoro-2-methyl-3,5-dinitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Fluoro-2-methyl-3,5-dinitrobenzene |
|---|
| CAS Number | 85233-16-5 | Molecular Weight | 200.124 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 303.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5FN2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.2±26.5 °C |
|---|
Names
| Name | 1-fluoro-2-methyl-3,5-dinitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 303.3±37.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H5FN2O4 |
|---|
| Molecular Weight | 200.124 |
|---|
| Flash Point | 137.2±26.5 °C |
|---|
| Exact Mass | 200.023331 |
|---|
| PSA | 91.64000 |
|---|
| LogP | 1.93 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.575 |
|---|
| InChIKey | JZFYAALVLGWFKH-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(F)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
|---|
Synonyms
| Benzene, 1-fluoro-2-methyl-3,5-dinitro- |
| 2,4-Dinitro-6-fluor-toluol |
| 2,4-DINITRO-6-FLUOROTOLUENE |
| 1-fluoranyl-2-methyl-3,5-dinitro-benzene |
| Benzene,1-fluoro-2-methyl-3,5-dinitro |
| 1-Fluoro-2-methyl-3,5-dinitrobenzene |
