Introduction：Basic information about CAS 959577-50-5|(3R,4S)-1-(tert-Butoxycarbonyl)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3R,4S)-1-(tert-Butoxycarbonyl)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid |
|---|
| CAS Number | 959577-50-5 | Molecular Weight | 336.340 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 495.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.6±28.7 °C |
|---|
Names
| Name | (3R,4S)-1-(tert-Butoxycarbonyl)-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 495.8±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H20N2O6 |
|---|
| Molecular Weight | 336.340 |
|---|
| Flash Point | 253.6±28.7 °C |
|---|
| Exact Mass | 336.132141 |
|---|
| PSA | 112.66000 |
|---|
| LogP | 2.28 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | PNIVAHKGWKAAIG-OLZOCXBDSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CC(C(=O)O)C(c2cccc([N+](=O)[O-])c2)C1 |
|---|
Synonyms
| 1-[(2-methylpropan-2-yl)oxycarbonyl]-4-(3-nitrophenyl)pyrrolidine-3-carboxylic acid |
| 1,3-Pyrrolidinedicarboxylic acid, 4-(3-nitrophenyl)-, 1-(1,1-dimethylethyl) ester, (3R,4S)- |
| (3R,4S)-1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-(3-nitrophenyl)-3-pyrrolidinecarboxylic acid |
