Introduction：Basic information about CAS 40130-25-4|2-ethoxy-4-nitrophenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-ethoxy-4-nitrophenol |
|---|
| CAS Number | 40130-25-4 | Molecular Weight | 183.16100 |
|---|
| Density | 1.306g/cm3 | Boiling Point | 342.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 161ºC |
|---|
Names
| Name | 2-ethoxy-4-nitrophenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.306g/cm3 |
|---|
| Boiling Point | 342.6ºC at 760mmHg |
|---|
| Molecular Formula | C8H9NO4 |
|---|
| Molecular Weight | 183.16100 |
|---|
| Flash Point | 161ºC |
|---|
| Exact Mass | 183.05300 |
|---|
| PSA | 75.28000 |
|---|
| LogP | 2.22230 |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | GIHYKBDWFSOKNN-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1cc([N+](=O)[O-])ccc1O |
|---|
Safety Information
Customs
| HS Code | 2909500000 |
|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 2-Aethoxy-4-nitro-phenol |
| 2-Ethoxy-4-nitro-phenol |
| 5-Nitro-2-hydroxy-1-aethoxy-benzol |
| Phenol,2-ethoxy-4-nitro |
| 3-ethoxy-4-hydroxynitrobenzene |
| EINECS 254-801-7 |
| Aethyl-(5-nitro-2-hydroxy-phenyl)-aether |
