Introduction：Basic information about CAS 4024-34-4|2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)ammonium chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-[(p-methyl-alpha-phenylbenzyl)oxy]ethyl(dimethyl)ammonium chloride |
|---|
| CAS Number | 4024-34-4 | Molecular Weight | 305.84200 |
|---|
| Density | / | Boiling Point | 362.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H24ClNO | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 107ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | dimethyl-[2-[(4-methylphenyl)-phenylmethoxy]ethyl]azanium,chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 362.5ºC at 760mmHg |
|---|
| Molecular Formula | C18H24ClNO |
|---|
| Molecular Weight | 305.84200 |
|---|
| Flash Point | 107ºC |
|---|
| Exact Mass | 305.15500 |
|---|
| PSA | 12.47000 |
|---|
| LogP | 4.46460 |
|---|
| InChIKey | BNFDLGUZDIWYJK-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(OCCN(C)C)c2ccccc2)cc1.Cl |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H302 |
|---|
| Precautionary Statements | P301 + P312 + P330 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| RTECS | KR6706600 |
|---|
Synonyms
| EINECS 223-691-2 |
| (+-)-dimethyl-[2-(-4-methyl-benzhydryloxy)-ethyl]-amine,hydrochloride |
| 4-Methyl-benzhydryl-(2-dimethylamino-ethyl)-ether |
| Neo-benodine |
| 2-[(4-methylphenyl)phenylmethoxy]-N,N-dimethylethanamine hydrochloride |
| dimethyl{2-[(4-methylphenyl)(phenyl)methoxy]ethyl}ammonium chloride |
| (+-)-Dimethyl-[2-(-4-methyl-benzhydryloxy)-aethyl]-amin,Hydrochlorid |
| Toladryl |
| Toladryl hydrochloride |
