Introduction：Basic information about CAS 435345-05-4|(3-Chloro-2-oxo-2H-pyrazin-1-yl)acetic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-Chloro-2-oxo-2H-pyrazin-1-yl)acetic acid ethyl ester |
|---|
| CAS Number | 435345-05-4 | Molecular Weight | 216.62200 |
|---|
| Density | 1.372g/cm3 | Boiling Point | 313.245ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9ClN2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 143.246ºC |
|---|
Names
| Name | ethyl 2-(5-chloro-6-oxo-1H-pyrazin-3-yl)acetate |
|---|
Chemical & Physical Properties
| Density | 1.372g/cm3 |
|---|
| Boiling Point | 313.245ºC at 760 mmHg |
|---|
| Molecular Formula | C8H9ClN2O3 |
|---|
| Molecular Weight | 216.62200 |
|---|
| Flash Point | 143.246ºC |
|---|
| Exact Mass | 216.03000 |
|---|
| PSA | 72.05000 |
|---|
| LogP | 0.52890 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | OCVFRZCHZZMMBI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)Cc1c[nH]c(=O)c(Cl)n1 |
|---|
