Introduction：Basic information about CAS 53970-67-5|2,3-Dihydro-7-methoxy-1H-cyclopenta[b]quinolin-9-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,3-Dihydro-7-methoxy-1H-cyclopenta[b]quinolin-9-amine |
|---|
| CAS Number | 53970-67-5 | Molecular Weight | 214.26300 |
|---|
| Density | 1.244g/cm3 | Boiling Point | 428.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 213ºC |
|---|
Names
| Name | 7-methoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.244g/cm3 |
|---|
| Boiling Point | 428.6ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14N2O |
|---|
| Molecular Weight | 214.26300 |
|---|
| Flash Point | 213ºC |
|---|
| Exact Mass | 214.11100 |
|---|
| PSA | 48.87000 |
|---|
| LogP | 2.24440 |
|---|
| Index of Refraction | 1.682 |
|---|
| InChIKey | JBZLIWVDIDZFCY-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2nc3c(c(N)c2c1)CCC3 |
|---|
Synonyms
| 9-Amino-7-methoxy-2,3-dihydro-1H-cyclopenta(b)quinoline |
| 7-Methoxy-2,3-dihydro-1H-cyclopenta[b]chinolin-9-ylamin |
| 1H-Cyclopenta(b)quinoline,2,3-dihydro-9-amino-7-methoxy |
| 7-methoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-ylamine |
