Introduction:Basic information about CAS 3010-83-1|Benzoic acid,3,3'-methylenebis-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzoic acid,3,3'-methylenebis- |
|---|
| CAS Number | 3010-83-1 | Molecular Weight | 256.25300 |
|---|
| Density | 1.321g/cm3 | Boiling Point | 500.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 270.7ºC |
|---|
Names
| Name | 3-[(3-carboxyphenyl)methyl]benzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.321g/cm3 |
|---|
| Boiling Point | 500.7ºC at 760mmHg |
|---|
| Molecular Formula | C15H12O4 |
|---|
| Molecular Weight | 256.25300 |
|---|
| Flash Point | 270.7ºC |
|---|
| Exact Mass | 256.07400 |
|---|
| PSA | 74.60000 |
|---|
| LogP | 2.67380 |
|---|
| Index of Refraction | 1.635 |
|---|
| InChIKey | RBQRPOWGQURLEU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccc(Cc2cccc(C(=O)O)c2)c1 |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Benzoic acid,3,3'-methylenebis |
| 3,3'-Diphenylmethan-dicarbonsaeure |
| Bis-<3-Carboxy-phenyl>-methan |
| 3,3'-methylenedibenzoic acid |
| 3,3'-Methandiyl-di-benzoesaeure |
| 3,3'-methanediyldibenzoic acid |