Introduction:Basic information about CAS 38215-38-2|4,4'-Diethynylbiphenyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4,4'-Diethynylbiphenyl |
|---|
| CAS Number | 38215-38-2 | Molecular Weight | 202.251 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 318.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C16H10 | Melting Point | 168 °C |
|---|
| MSDS | / | Flash Point | 138.4±20.1 °C |
|---|
Names
| Name | 1-ethynyl-4-(4-ethynylphenyl)benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 318.2±35.0 °C at 760 mmHg |
|---|
| Melting Point | 168 °C |
|---|
| Molecular Formula | C16H10 |
|---|
| Molecular Weight | 202.251 |
|---|
| Flash Point | 138.4±20.1 °C |
|---|
| Exact Mass | 202.078247 |
|---|
| LogP | 4.34 |
|---|
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.627 |
|---|
| InChIKey | MXJJMQSKDPNPSX-UHFFFAOYSA-N |
|---|
| SMILES | C#Cc1ccc(-c2ccc(C#C)cc2)cc1 |
|---|
Safety Information
Customs
| HS Code | 2902909090 |
|---|
| Summary | 2902909090 other aromatic hydrocarbons。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:2.0%。General tariff:30.0% |
|---|
Synonyms
| 4,4'-Diethynylbiphenyl |
| 4'',4'''-dipyridyl-4,4'-diethynylbiphenyl |
| 1,1'-Biphenyl, 4,4'-diethynyl- |
| 1,1'-Diethynyl-4,4'-biphenyl |
| 4,4'-bisethynyl-1,1'-biphenyl |
| D4233 |
| 4,4'-bis-ethynyl-2,2'-biphenyl |
| 1,1'-Biphenyl,4,4'-diethynyl |
| 4,4'-Diacetylenebiphenyl |
| 4,4'-Diethynyl-1,1'-biphenyl |