Introduction：Basic information about CAS 116183-79-0|(S)-1-Benzyl-3-[(p-tolylsulfonyl)oxy]pyrrolidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-1-Benzyl-3-[(p-tolylsulfonyl)oxy]pyrrolidine |
|---|
| CAS Number | 116183-79-0 | Molecular Weight | 331.42900 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 466.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21NO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.8ºC |
|---|
Names
| Name | [(3S)-1-benzylpyrrolidin-3-yl] 4-methylbenzenesulfonate |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 466.3ºC at 760 mmHg |
|---|
| Molecular Formula | C18H21NO3S |
|---|
| Molecular Weight | 331.42900 |
|---|
| Flash Point | 235.8ºC |
|---|
| Exact Mass | 331.12400 |
|---|
| PSA | 54.99000 |
|---|
| LogP | 3.99350 |
|---|
| Vapour Pressure | 7.15E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | DFFINYKUAYHRBO-KRWDZBQOSA-N |
|---|
| SMILES | Cc1ccc(S(=O)(=O)OC2CCN(Cc3ccccc3)C2)cc1 |
|---|
