Introduction：Basic information about CAS 874459-69-5|(3-(N-(tert-butyl)sulfamoyl)-4-Methoxyphenyl)boronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (3-(N-(tert-butyl)sulfamoyl)-4-Methoxyphenyl)boronic acid |
|---|
| CAS Number | 874459-69-5 | Molecular Weight | 287.140 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 486.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H18BNO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 247.9±31.5 °C |
|---|
Names
| Name | Boronic acid, B-[3-[[(1,1-dimethylethyl)amino]sulfonyl]-4-methoxyphenyl] |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 486.3±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H18BNO5S |
|---|
| Molecular Weight | 287.140 |
|---|
| Flash Point | 247.9±31.5 °C |
|---|
| Exact Mass | 287.099884 |
|---|
| PSA | 104.24000 |
|---|
| LogP | 1.49 |
|---|
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.548 |
|---|
| InChIKey | LLWKYPQKXDZYMQ-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(B(O)O)cc1S(=O)(=O)NC(C)(C)C |
|---|
Synonyms
| Boronic acid, B-[3-[[(1,1-dimethylethyl)amino]sulfonyl]-4-methoxyphenyl]- |
| (3-(N-(tert-butyl)sulfamoyl)-4-methoxyphenyl)boronic acid |
| {4-Methoxy-3-[(2-methyl-2-propanyl)sulfamoyl]phenyl}boronic acid |
| Boronic acid, [3-[[(1,1-dimethylethyl)amino]sulfonyl]-4-methoxyphenyl]- |
