Introduction：Basic information about CAS 5730-92-7|4-ACETYL-4'-ETHYLBIPHENYL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-ACETYL-4'-ETHYLBIPHENYL |
|---|
| CAS Number | 5730-92-7 | Molecular Weight | 224.29800 |
|---|
| Density | 1.023g/cm3 | Boiling Point | 350.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.6ºC |
|---|
Names
| Name | 1-[4-(4-ethylphenyl)phenyl]ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.023g/cm3 |
|---|
| Boiling Point | 350.8ºC at 760 mmHg |
|---|
| Molecular Formula | C16H16O |
|---|
| Molecular Weight | 224.29800 |
|---|
| Flash Point | 150.6ºC |
|---|
| Exact Mass | 224.12000 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 4.11860 |
|---|
| Index of Refraction | 1.556 |
|---|
| InChIKey | JVHINSBYQLJNIW-UHFFFAOYSA-N |
|---|
| SMILES | CCc1ccc(-c2ccc(C(C)=O)cc2)cc1 |
|---|
Synonyms
| 1-(4'-Aethyl-biphenyl-4-yl)-aethanon |
| 4-acetyl-4'-ethyl-biphenyl |
| 1-(4'-ethylbiphenyl-4-yl)ethanone |
| 4'-ethyl-4-acetylbiphenyl |
| 1-(4'-ethyl[1,1'-biphenyl]-4-yl)-1-ethanone |
