Introduction:Basic information about CAS 38568-21-7|2,2-dibromohexafluoropropane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,2-dibromohexafluoropropane |
|---|
| CAS Number | 38568-21-7 | Molecular Weight | 309.83100 |
|---|
| Density | 2.257g/cm3 | Boiling Point | 72ºC |
|---|
| Molecular Formula | C3Br2F6 | Melting Point | 52-53ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,2-dibromo-1,1,1,3,3,3-hexafluoropropane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.257g/cm3 |
|---|
| Boiling Point | 72ºC |
|---|
| Melting Point | 52-53ºC |
|---|
| Molecular Formula | C3Br2F6 |
|---|
| Molecular Weight | 309.83100 |
|---|
| Exact Mass | 307.82700 |
|---|
| LogP | 3.59710 |
|---|
| Index of Refraction | 1.386 |
|---|
| InChIKey | VCRVQFFAKUROKA-UHFFFAOYSA-N |
|---|
| SMILES | FC(F)(F)C(Br)(Br)C(F)(F)F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| HS Code | 2903799090 |
|---|
Customs
| HS Code | 2903799090 |
|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| PC9365 |
| 2,2-DI(2-TETRAHYDROFURYL)PROPANE |
| 2,2-Dibromohexafluoropropane |
| 2,2-bis(bromanyl)-1,1,1,3,3,3-hexakis(fluoranyl)propane |
| Propane,2,2-dibromohexafluoro |
| 2,2-Dibrom-1,1,1,3,3,3-hexafluorpropan |
| hexafluoroisopropylidene dibromide |
| 2,2-dibromo-1,1,1,3,3,3-hexafluoro-propane |