Introduction:Basic information about CAS 147568-66-9|Carmoterol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Carmoterol |
|---|
| CAS Number | 147568-66-9 | Molecular Weight | 368.426 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 649.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H24N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 346.4±31.5 °C |
|---|
Names
| Name | 8-Hydroxy-5-((R)-1-hydroxy-2-(((R)-1-(4-methoxyphenyl)propan-2-yl)amino)ethyl)quinolin-2(1H)-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 649.2±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C21H24N2O4 |
|---|
| Molecular Weight | 368.426 |
|---|
| Flash Point | 346.4±31.5 °C |
|---|
| Exact Mass | 368.173615 |
|---|
| PSA | 94.58000 |
|---|
| LogP | 1.90 |
|---|
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.616 |
|---|
| InChIKey | IHOXNOQMRZISPV-YJYMSZOUSA-N |
|---|
| SMILES | COc1ccc(CC(C)NCC(O)c2ccc(O)c3[nH]c(=O)ccc23)cc1 |
|---|
Synonyms
| 2(1H)-Quinolinone, 8-hydroxy-5-[(1R)-1-hydroxy-2-[[(1R)-2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]- |
| 8-Hydroxy-5-[(1R)-1-hydroxy-2-{[(2R)-1-(4-methoxyphenyl)-2-propanyl]amino}ethyl]-2(1H)-quinolinone |
| Carmoterol |
| 8-hydroxy-5-[1-hydroxy-2-[2-(4-methoxyphenyl)propan-2-ylamino]ethyl]-1H-quinolin-2-one |