Introduction：Basic information about CAS 83242-95-9|Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Octyl(phenyl)-N,N-diisobutylcarbamoylmethylphosphine oxide |
|---|
| CAS Number | 83242-95-9 | Molecular Weight | 407.569 |
|---|
| Density | 1.0±0.1 g/cm3 | Boiling Point | 549.0±42.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H42NO2P | Melting Point | 180°C (dec.) (lit.) |
|---|
| MSDS | / | Flash Point | 285.8±27.9 °C |
|---|
Names
| Name | N,N-bis(2-methylpropyl)-2-[octyl(phenyl)phosphoryl]acetamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.0±0.1 g/cm3 |
|---|
| Boiling Point | 549.0±42.0 °C at 760 mmHg |
|---|
| Melting Point | 180°C (dec.) (lit.) |
|---|
| Molecular Formula | C24H42NO2P |
|---|
| Molecular Weight | 407.569 |
|---|
| Flash Point | 285.8±27.9 °C |
|---|
| Exact Mass | 407.295319 |
|---|
| PSA | 47.19000 |
|---|
| LogP | 5.71 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.495 |
|---|
| InChIKey | SGZRFMMIONYDQU-UHFFFAOYSA-N |
|---|
| SMILES | CCCCCCCCP(=O)(CC(=O)N(CC(C)C)CC(C)C)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
Synonyms
| N,N-Diisobutyl-2-[octyl(phenyl)phosphoryl]acetamide |
| Acetamide,N,N-bis(2-methylpropyl)-2-(octylphenylphosphinyl) |
| 1-Decanone, 1-[bis(2-methylpropyl)nitroryl]-2-phenyl-2-phosphino- |
| (N,N-diisobutylcarbamoylmethyl)phenyloctylphosphine oxide |
| 1-(Diisobutylnitroryl)-2-phenyl-2-phosphino-1-decanone |
| N,N-Diisobutyl-2-(octyl(phenyl)phosphoryl)acetamide |
| Acetamide, N,N-bis(2-methylpropyl)-2-(octylphenylphosphinyl)- |
