Introduction:Basic information about CAS 142217-81-0|2-amino-9-((1S,3R,4S)-4-(benzyloxy)-3-(benzyloxymethyl)-2-methylenecyclopentyl)-1H-p, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-amino-9-((1S,3R,4S)-4-(benzyloxy)-3-(benzyloxymethyl)-2-methylenecyclopentyl)-1H-purin-6(9H)-one |
|---|
| CAS Number | 142217-81-0 | Molecular Weight | 457.524 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C26H27N5O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2-amino-9-((1S,3R,4S)-4-(benzyloxy)-3-(benzyloxymethyl)-2-methylenecyclopentyl)-1H-purin-6(9H)-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Molecular Formula | C26H27N5O3 |
|---|
| Molecular Weight | 457.524 |
|---|
| Exact Mass | 457.211395 |
|---|
| PSA | 108.05000 |
|---|
| LogP | 3.97 |
|---|
| Index of Refraction | 1.679 |
|---|
| InChIKey | KROVOOOAPHSWCR-FKBYEOEOSA-N |
|---|
| SMILES | C=C1C(COCc2ccccc2)C(OCc2ccccc2)CC1n1cnc2c(=O)[nH]c(N)nc21 |
|---|
Synonyms
| Entecavir InterMediate VIII IsoMer |
| 3',5'-Di-O-benzyl Entecavir |
| Entecavir-9 |
| 2-Amino-9-{(1S,3R,4S)-4-(benzyloxy)-3-[(benzyloxy)methyl]-2-methylenecyclopentyl}-1,9-dihydro-6H-purin-6-one |
| 6H-Purin-6-one, 2-amino-1,9-dihydro-9-[(1S,3R,4S)-2-methylene-4-(phenylmethoxy)-3-[(phenylmethoxy)methyl]cyclopentyl]- |
| Entecavir E8 |
| Entecavir InterMediate N-1 |
| Entecavir Impurity 16 |