Introduction：Basic information about CAS 70124-98-0|2-(p-hydroxyphenyl)isovaleric acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(p-hydroxyphenyl)isovaleric acid |
|---|
| CAS Number | 70124-98-0 | Molecular Weight | 194.22700 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 342.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.3ºC |
|---|
Names
| Name | 2-(4-hydroxyphenyl)-3-methylbutyric acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 342.8ºC at 760 mmHg |
|---|
| Molecular Formula | C11H14O3 |
|---|
| Molecular Weight | 194.22700 |
|---|
| Flash Point | 175.3ºC |
|---|
| Exact Mass | 194.09400 |
|---|
| PSA | 57.53000 |
|---|
| LogP | 2.21640 |
|---|
| Index of Refraction | 1.553 |
|---|
| InChIKey | GDBITPXOESTAML-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)C(C(=O)O)c1ccc(O)cc1 |
|---|
Synonyms
| 2-(4-hydroxyphenyl)-3-methylbutanoic acid |
| S821 |
| EINECS 274-323-2 |
