Introduction：Basic information about CAS 4356-82-5|Methyl 2,3,4-tris-O-(phenylmethyl)-β-D-glucopyranosiduronic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2,3,4-tris-O-(phenylmethyl)-β-D-glucopyranosiduronic acid |
|---|
| CAS Number | 4356-82-5 | Molecular Weight | 478.53400 |
|---|
| Density | 1.25 g/cm3 | Boiling Point | 626.2ºC at 760 mmHg |
|---|
| Molecular Formula | C28H30O7 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 205.5ºC |
|---|
Names
| Name | Methyl 2,3,4-tris-O-(phenylmethyl)-β-D-glucopyranosiduronic acid |
|---|
Chemical & Physical Properties
| Density | 1.25 g/cm3 |
|---|
| Boiling Point | 626.2ºC at 760 mmHg |
|---|
| Molecular Formula | C28H30O7 |
|---|
| Molecular Weight | 478.53400 |
|---|
| Flash Point | 205.5ºC |
|---|
| Exact Mass | 478.19900 |
|---|
| PSA | 83.45000 |
|---|
| LogP | 4.19850 |
|---|
| Index of Refraction | 1.602 |
|---|
| InChIKey | YNRUVHJHQXLZGX-YYDZWWTMSA-N |
|---|
| SMILES | COC1OC(C(=O)O)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
|---|
