Introduction:Basic information about CAS 154862-43-8|3,9-Bis(2,4-dicumylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5], including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,9-Bis(2,4-dicumylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5] |
|---|
| CAS Number | 154862-43-8 | Molecular Weight | 852.97200 |
|---|
| Density | / | Boiling Point | 778.2ºC at 760mmHg |
|---|
| Molecular Formula | C53H58O6P2 | Melting Point | 229-232ºC(lit.) |
|---|
| MSDS | USA | Flash Point | 537.9ºC |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 3 9-bis(2 4-dicumylphenoxy)-2 4 8 10-te& |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 778.2ºC at 760mmHg |
|---|
| Melting Point | 229-232ºC(lit.) |
|---|
| Molecular Formula | C53H58O6P2 |
|---|
| Molecular Weight | 852.97200 |
|---|
| Flash Point | 537.9ºC |
|---|
| Exact Mass | 852.37100 |
|---|
| PSA | 82.56000 |
|---|
| LogP | 13.98180 |
|---|
| Vapour Pressure | 3.35E-23mmHg at 25°C |
|---|
| InChIKey | WBWXVCMXGYSMQA-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(c1ccccc1)c1ccc(OP2OCC3(CO2)COP(Oc2ccc(C(C)(C)c4ccccc4)cc2C(C)(C)c2ccccc2)OC3)c(C(C)(C)c2ccccc2)c1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 3,9-Bis(2,4-dicumylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5] |
| Bis(2,4-dicumylphenyl)pentaerythritol diphosphit |
| BIS(2,4-DICUMYL-PHENYL)PENTA-ERYTHRITOL-DIPHOSPHITE |
| 2,4,8,10-Tetraoxa-3,9-diphosphaspiro5.5undecane,3,9-bis2,4-bis(1-methyl-1-phenylethyl)phenoxy |
| 3,9-BIS(2,4-DICUMYLPHENOXY)-2,4,8,10-TET |
| BIS(2,4-DICUMYLPHENYL)PENTAERYTHRITOLDISPHOSPHITE |
| S-9228 |
| MFCD00274221 |
| 3,9-bis(2,4-dicumylphenoxy)-2,4,8,10-tetra-oxa-3 |