Introduction：Basic information about CAS 14331-22-7|5H-Tetrazole-5-thione,1,2-dihydro-1-(1-naphthalenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5H-Tetrazole-5-thione,1,2-dihydro-1-(1-naphthalenyl)- |
|---|
| CAS Number | 14331-22-7 | Molecular Weight | 228.27300 |
|---|
| Density | 1.44g/cm3 | Boiling Point | 352.6ºC at 760mmHg |
|---|
| Molecular Formula | C11H8N4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 167.1ºC |
|---|
Names
| Name | 1-naphthalen-1-yl-2H-tetrazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.44g/cm3 |
|---|
| Boiling Point | 352.6ºC at 760mmHg |
|---|
| Molecular Formula | C11H8N4S |
|---|
| Molecular Weight | 228.27300 |
|---|
| Flash Point | 167.1ºC |
|---|
| Exact Mass | 228.04700 |
|---|
| PSA | 78.59000 |
|---|
| LogP | 2.47810 |
|---|
| Vapour Pressure | 3.78E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.777 |
|---|
| InChIKey | QUFRGNOIJAGRFY-UHFFFAOYSA-N |
|---|
| SMILES | S=c1nn[nH]n1-c1cccc2ccccc12 |
|---|
Synonyms
| 1-(1-naphthyl)-1H-tetrazole-5-thiol |
| 1-naphthalen-1-yl-1,4-dihydro-tetrazole-5-thione |
| 1,2-dihydro-1-naphthyl-5H-tetrazole-5-thione |
| 1-(naphthalen-1-yl)-1H-tetrazole-5-thiol |
| EINECS 238-275-6 |
