Introduction：Basic information about CAS 67990-32-3|bis(2,4,6-tribromophenyl) carbonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | bis(2,4,6-tribromophenyl) carbonate |
|---|
| CAS Number | 67990-32-3 | Molecular Weight | 687.59300 |
|---|
| Density | 2.49g/cm3 | Boiling Point | 546.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H4Br6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 284.3ºC |
|---|
Names
| Name | bis(2,4,6-tribromophenyl) carbonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.49g/cm3 |
|---|
| Boiling Point | 546.4ºC at 760 mmHg |
|---|
| Molecular Formula | C13H4Br6O3 |
|---|
| Molecular Weight | 687.59300 |
|---|
| Flash Point | 284.3ºC |
|---|
| Exact Mass | 681.52600 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 7.83940 |
|---|
| Index of Refraction | 1.688 |
|---|
| InChIKey | KYCZCJACRVPWFK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Oc1c(Br)cc(Br)cc1Br)Oc1c(Br)cc(Br)cc1Br |
|---|
Synonyms
| EINECS 268-053-4 |
| Phenol,2,4,6-tribromo-,1,1'-carbonate |
| Phenol,2,4,6-tribromo-,carbonate (2:1) |
