Introduction：Basic information about CAS 67953-76-8|1-Hydroxyethylidene-1,1-diphosphonic acid potassium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Hydroxyethylidene-1,1-diphosphonic acid potassium salt |
|---|
| CAS Number | 67953-76-8 | Molecular Weight | 358.39000 |
|---|
| Density | / | Boiling Point | 578.8ºC at 760mmHg |
|---|
| Molecular Formula | C2H4K4O7P2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 303.8ºC |
|---|
Names
| Name | 1-Hydroxyethanediphosphonic acid potassium salt |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 578.8ºC at 760mmHg |
|---|
| Molecular Formula | C2H4K4O7P2 |
|---|
| Molecular Weight | 358.39000 |
|---|
| Flash Point | 303.8ºC |
|---|
| Exact Mass | 357.79800 |
|---|
| PSA | 166.23000 |
|---|
| LogP | 0.76060 |
|---|
| InChIKey | REUWUOGTZKUGNC-UHFFFAOYSA-N |
|---|
| SMILES | CC(O)(P(=O)(O)O)P(=O)(O)O.[K] |
|---|
Synonyms
| potassium 1-hydroxyethylidene diphosphonate |
| Potassium salt of 1-Hydroxy Ethylidene-1,1- Diphosphonic Acid |
| HEDP.Kx |
| 1-Hydroxyethane-1,1-diphosphonic acid potassium salt |
