Introduction:Basic information about CAS 19748-58-4|1,3,4-Oxadiazole,2,5-bis(3-methoxyphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3,4-Oxadiazole,2,5-bis(3-methoxyphenyl)- |
|---|
| CAS Number | 19748-58-4 | Molecular Weight | 282.29400 |
|---|
| Density | 1.189g/cm3 | Boiling Point | 461.8ºC at 760mmHg |
|---|
| Molecular Formula | C16H14N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233.1ºC |
|---|
Names
| Name | 2,5-bis(3-methoxyphenyl)-1,3,4-oxadiazole |
|---|
Chemical & Physical Properties
| Density | 1.189g/cm3 |
|---|
| Boiling Point | 461.8ºC at 760mmHg |
|---|
| Molecular Formula | C16H14N2O3 |
|---|
| Molecular Weight | 282.29400 |
|---|
| Flash Point | 233.1ºC |
|---|
| Exact Mass | 282.10000 |
|---|
| PSA | 57.38000 |
|---|
| LogP | 3.42080 |
|---|
| Vapour Pressure | 2.87E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | VTFRIPCUJGVYKU-UHFFFAOYSA-N |
|---|
| SMILES | COc1cccc(-c2nnc(-c3cccc(OC)c3)o2)c1 |
|---|
Safety Information