Introduction：Basic information about CAS 156755-23-6|6-Bromo-4-phenylchroman-2-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Bromo-4-phenylchroman-2-one |
|---|
| CAS Number | 156755-23-6 | Molecular Weight | 303.151 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 373.7±41.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H11BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 179.8±27.6 °C |
|---|
Names
| Name | 6-bromo-4-phenyl-3,4-dihydrochromen-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 373.7±41.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H11BrO2 |
|---|
| Molecular Weight | 303.151 |
|---|
| Flash Point | 179.8±27.6 °C |
|---|
| Exact Mass | 301.994232 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 4.18 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | KFKFQGCDFMGUCH-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CC(c2ccccc2)c2cc(Br)ccc2O1 |
|---|
Synonyms
| 6-Bromo-4-phenyl-2-chromanone |
| 6-Bromo-3,4-dihydro-4-phenyl-2H-1-benzopyran-2-one |
| 2H-1-Benzopyran-2-one, 6-bromo-3,4-dihydro-4-phenyl-, (±)- |
| 2H-1-Benzopyran-2-one, 6-bromo-3,4-dihydro-4-phenyl- |
| 6-Bromo-4-phenyl-3,4-dihydro-coumarine |
| 6-bromo-4-phenyl-3,4-dihydro-2H-chromen-2-one |
| T66 BOVT&J ER& HE |
| 6-Bromo-4-phenyl-3,4-dihydrochromen-2-one |
| 6-Bromo-4-phenylchroman-2-one |
