Introduction：Basic information about CAS 38475-36-4|3-bromo-5-tert-butylbenzene-1,2-diol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-bromo-5-tert-butylbenzene-1,2-diol |
|---|
| CAS Number | 38475-36-4 | Molecular Weight | 245.113 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 288.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 128.4±25.9 °C |
|---|
Names
| Name | 3-bromo-5-tert-butyl-1,2-dihydroxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 288.7±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H13BrO2 |
|---|
| Molecular Weight | 245.113 |
|---|
| Flash Point | 128.4±25.9 °C |
|---|
| Exact Mass | 244.009888 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 3.93 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | XGWHVLKOISKVLR-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)c1cc(O)c(O)c(Br)c1 |
|---|
Safety Information
Customs
| HS Code | 2908199090 |
|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
|---|
Synonyms
| 3-BROMO-5-TERT-BUTYLBENZENE-1,2-DIOL |
| 1,2-Benzenediol, 3-bromo-5-(1,1-dimethylethyl)- |
| 3-Brom-5-t-butylbrenzcatechin |
| 3-bromo-5-t-butylcatechol |
| 3-Bromo-5-(2-methyl-2-propanyl)-1,2-benzenediol |
| 3-bromo-5-tert-butyl-pyrocatechol |
| 3-Brom-5-tert-butyl-brenzcatechin |
