Introduction:Basic information about CAS 119618-22-3|S-OXYBUTYNIN, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | S-OXYBUTYNIN |
|---|
| CAS Number | 119618-22-3 | Molecular Weight | 357.48600 |
|---|
| Density | 1.097 | Boiling Point | 494.4ºC at 760 mmHg |
|---|
| Molecular Formula | C22H31NO3 | Melting Point | 52-54ºC |
|---|
| MSDS | / | Flash Point | 252.8ºC |
|---|
Names
| Name | esoxybutynin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.097 |
|---|
| Boiling Point | 494.4ºC at 760 mmHg |
|---|
| Melting Point | 52-54ºC |
|---|
| Molecular Formula | C22H31NO3 |
|---|
| Molecular Weight | 357.48600 |
|---|
| Flash Point | 252.8ºC |
|---|
| Exact Mass | 357.23000 |
|---|
| PSA | 49.77000 |
|---|
| LogP | 3.34290 |
|---|
| Vapour Pressure | 1.37E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.546 |
|---|
| InChIKey | XIQVNETUBQGFHX-JOCHJYFZSA-N |
|---|
| SMILES | CCN(CC)CC#CCOC(=O)C(O)(c1ccccc1)C1CCCCC1 |
|---|
Synonyms
| 4-(diethylamino)but-2-ynyl (2S)-2-cyclohexyl-2-hydroxy-2-phenylacetate |
| Lopac-O-2881 |