Introduction：Basic information about CAS 117420-80-1|5-(benzenesulfonyl)-2-methylsulfanyl-1,3-thiazol-4-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-(benzenesulfonyl)-2-methylsulfanyl-1,3-thiazol-4-amine |
|---|
| CAS Number | 117420-80-1 | Molecular Weight | 286.39400 |
|---|
| Density | 1.53g/cm3 | Boiling Point | 535.7ºC at 760 mmHg |
|---|
| Molecular Formula | C10H10N2O2S3 | Melting Point | 143-145ºC |
|---|
| MSDS | / | Flash Point | 277.8ºC |
|---|
Names
| Name | 5-(benzenesulfonyl)-2-methylsulfanyl-1,3-thiazol-4-amine |
|---|
Chemical & Physical Properties
| Density | 1.53g/cm3 |
|---|
| Boiling Point | 535.7ºC at 760 mmHg |
|---|
| Melting Point | 143-145ºC |
|---|
| Molecular Formula | C10H10N2O2S3 |
|---|
| Molecular Weight | 286.39400 |
|---|
| Flash Point | 277.8ºC |
|---|
| Exact Mass | 285.99000 |
|---|
| PSA | 134.97000 |
|---|
| LogP | 3.94200 |
|---|
| Vapour Pressure | 1.51E-11mmHg at 25°C |
|---|
| Index of Refraction | 1.705 |
|---|
| InChIKey | LCVIYMPXPXZRLD-UHFFFAOYSA-N |
|---|
| SMILES | CSc1nc(N)c(S(=O)(=O)c2ccccc2)s1 |
|---|
