Introduction：Basic information about CAS 4397-91-5|Nicofurate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nicofurate |
|---|
| CAS Number | 4397-91-5 | Molecular Weight | 680.61700 |
|---|
| Density | 1.372 g/cm3 | Boiling Point | 838.7ºC at 760mmHg |
|---|
| Molecular Formula | C35H28N4O11 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 461ºC |
|---|
Names
| Name | Nicofurate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.372 g/cm3 |
|---|
| Boiling Point | 838.7ºC at 760mmHg |
|---|
| Molecular Formula | C35H28N4O11 |
|---|
| Molecular Weight | 680.61700 |
|---|
| Flash Point | 461ºC |
|---|
| Exact Mass | 680.17500 |
|---|
| PSA | 196.20000 |
|---|
| LogP | 4.16090 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | BNYZXONJFQJYPC-IDZRBWSNSA-N |
|---|
| SMILES | COC(=O)c1cc(C(OC(=O)c2cccnc2)C(OC(=O)c2cccnc2)C(COC(=O)c2cccnc2)OC(=O)c2cccnc2)oc1C |
|---|
Synonyms
| Tetnicoran |
| Tetranicotinate |
| Arteriolate |
