Introduction：Basic information about CAS 5579-08-8|Propyl docetrizoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Propyl docetrizoate |
|---|
| CAS Number | 5579-08-8 | Molecular Weight | 640.97900 |
|---|
| Density | 2.196g/cm3 | Boiling Point | 625.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H14I3NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 332.3ºC |
|---|
Names
| Name | propyl 3-(diacetylamino)-2,4,6-triiodobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 2.196g/cm3 |
|---|
| Boiling Point | 625.9ºC at 760mmHg |
|---|
| Molecular Formula | C14H14I3NO4 |
|---|
| Molecular Weight | 640.97900 |
|---|
| Flash Point | 332.3ºC |
|---|
| Exact Mass | 640.80600 |
|---|
| PSA | 63.68000 |
|---|
| LogP | 3.96660 |
|---|
| Index of Refraction | 1.675 |
|---|
| InChIKey | DEVLRUOLAOLLCZ-UHFFFAOYSA-N |
|---|
| SMILES | CCCOC(=O)c1c(I)cc(I)c(N(C(C)=O)C(C)=O)c1I |
|---|
Synonyms
| Pulmidol |
| Propyl docetrizoate |
| UNII-0B62S0B44U |
