Introduction：Basic information about CAS 59752-23-7|Benderizine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benderizine |
|---|
| CAS Number | 59752-23-7 | Molecular Weight | 430.58200 |
|---|
| Density | 1.088g/cm3 | Boiling Point | 525ºC at 760 mmHg |
|---|
| Molecular Formula | C28H34N2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.3ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.088g/cm3 |
|---|
| Boiling Point | 525ºC at 760 mmHg |
|---|
| Molecular Formula | C28H34N2O2 |
|---|
| Molecular Weight | 430.58200 |
|---|
| Flash Point | 137.3ºC |
|---|
| Exact Mass | 430.26200 |
|---|
| PSA | 24.94000 |
|---|
| LogP | 4.91780 |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | HBIDWFPFQACMBQ-MUUNZHRXSA-N |
|---|
| SMILES | COc1ccc(CC2(C)CN(C(c3ccccc3)c3ccccc3)CCN2C)cc1OC |
|---|
