Introduction：Basic information about CAS 913-86-0|1,2-Ethanediol, 1,1,2,2-tetrakis(4-methylphenyl)-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Ethanediol, 1,1,2,2-tetrakis(4-methylphenyl)- |
|---|
| CAS Number | 913-86-0 | Molecular Weight | 422.55800 |
|---|
| Density | 1.139 g/cm3 | Boiling Point | 560ºC at 760 mmHg |
|---|
| Molecular Formula | C30H30O2 | Melting Point | 177ºC |
|---|
| MSDS | / | Flash Point | 239ºC |
|---|
Names
| Name | 1,1,2,2-tetrakis(4-methylphenyl)ethane-1,2-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.139 g/cm3 |
|---|
| Boiling Point | 560ºC at 760 mmHg |
|---|
| Melting Point | 177ºC |
|---|
| Molecular Formula | C30H30O2 |
|---|
| Molecular Weight | 422.55800 |
|---|
| Flash Point | 239ºC |
|---|
| Exact Mass | 422.22500 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 6.09220 |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | UWVQXJFNNKWNLZ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(O)(c2ccc(C)cc2)C(O)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
|---|
Synonyms
| Tetra-p-tolyl-aethan-1,2-diol |
| 1.2-Dihydroxy-1.1.2.2-tetra-p-tolyl-aethan |
| MFCD01321188 |
| 4.4'.4''.4'''-Tetramethyl-benzpinakon |
| tetra-p-tolyl-ethane-1,2-diol |
