Introduction:Basic information about CAS 127095-92-5|(R)-2-tert-Butoxycarbonylamino-3-cyclohexylpropionic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (R)-2-tert-Butoxycarbonylamino-3-cyclohexylpropionic acid |
|---|
| CAS Number | 127095-92-5 | Molecular Weight | 271.353 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 420.4±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H25NO4 | Melting Point | 64-67ºC |
|---|
| MSDS | USA | Flash Point | 208.1±24.0 °C |
|---|
Names
| Name | (R)-2-((tert-Butoxycarbonyl)amino)-3-cyclohexylpropanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 420.4±28.0 °C at 760 mmHg |
|---|
| Melting Point | 64-67ºC |
|---|
| Molecular Formula | C14H25NO4 |
|---|
| Molecular Weight | 271.353 |
|---|
| Flash Point | 208.1±24.0 °C |
|---|
| Exact Mass | 271.178345 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.69 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.484 |
|---|
| InChIKey | MSZQAQJBXGTSHP-LLVKDONJSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(CC1CCCCC1)C(=O)O |
|---|
| Storage condition | −20°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (2R)-3-cyclohexyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| N-Boc-3-cyclohexyl-D-alanine |
| (S)-2-tert-Butoxycarbonylamino-3-cyclohexyl-propionic acid |
| Cyclohexanepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, (αS)- |
| 3-Cyclohexyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}alanine |
| MFCD03839364 |
| Boc-D-Cha-OH |
| N-(tert-Butoxycarbonyl)-3-cyclohexyl-L-alanine |
| (R)-2-tert-Butoxycarbonylamino-3-cyclohexylpropionic acid |