Introduction：Basic information about CAS 80343-63-1|Sufotidine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sufotidine |
|---|
| CAS Number | 80343-63-1 | Molecular Weight | 421.55700 |
|---|
| Density | 1.27g/cm3 | Boiling Point | 657.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H31N5O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 351.3ºC |
|---|
Names
| Name | 2-methyl-5-(methylsulfonylmethyl)-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazol-3-amine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.27g/cm3 |
|---|
| Boiling Point | 657.3ºC at 760 mmHg |
|---|
| Molecular Formula | C20H31N5O3S |
|---|
| Molecular Weight | 421.55700 |
|---|
| Flash Point | 351.3ºC |
|---|
| Exact Mass | 421.21500 |
|---|
| PSA | 97.73000 |
|---|
| LogP | 3.31830 |
|---|
| Index of Refraction | 1.614 |
|---|
| InChIKey | JEYKZWRXDALMNG-UHFFFAOYSA-N |
|---|
| SMILES | Cn1nc(CS(C)(=O)=O)nc1NCCCOc1cccc(CN2CCCCC2)c1 |
|---|
Synonyms
| Sufotidina |
| Sufotidine |
| Sufotidina [Spanish] |
| Sufotidinum [Latin] |
| 1-methyl-3-[(methylsulfonyl)methyl]-n-{3-[3-(piperidin-1-ylmethyl)phenoxy]propyl}-1h-1,2,4-triazol-5-amine |
| Sufotidine (USAN/INN) |
| Sufotidinum |
