Introduction：Basic information about CAS 119-85-7|4-[[(4-hydroxy-3-methoxyphenyl)-(4-sulfamoylanilino)methyl]amino]benzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[[(4-hydroxy-3-methoxyphenyl)-(4-sulfamoylanilino)methyl]amino]benzenesulfonamide |
|---|
| CAS Number | 119-85-7 | Molecular Weight | 478.54200 |
|---|
| Density | 1.521g/cm3 | Boiling Point | 782.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H22N4O6S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 427.2ºC |
|---|
Names
| Name | 4-[[(4-hydroxy-3-methoxyphenyl)-(4-sulfamoylanilino)methyl]amino]benzenesulfonamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.521g/cm3 |
|---|
| Boiling Point | 782.8ºC at 760mmHg |
|---|
| Molecular Formula | C20H22N4O6S2 |
|---|
| Molecular Weight | 478.54200 |
|---|
| Flash Point | 427.2ºC |
|---|
| Exact Mass | 478.09800 |
|---|
| PSA | 190.60000 |
|---|
| LogP | 5.62660 |
|---|
| Vapour Pressure | 2.01E-25mmHg at 25°C |
|---|
| Index of Refraction | 1.694 |
|---|
| InChIKey | XMLCDJOGFNNCSF-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(Nc2ccc(S(N)(=O)=O)cc2)Nc2ccc(S(N)(=O)=O)cc2)ccc1O |
|---|
Synonyms
| Vanyldisulfanilamidum |
| Vanyldisulfamidum |
| UNII-541ZDL2E7U |
| Vanyldisulfamide |
| n4,n4'-vanilylidenebis(sulfanilamide) |
| Vanildisulfamida |
