Introduction：Basic information about CAS 59032-40-5|Disulergine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Disulergine |
|---|
| CAS Number | 59032-40-5 | Molecular Weight | 348.46300 |
|---|
| Density | 1.36g/cm3 | Boiling Point | 544.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H24N4O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 283.3ºC |
|---|
Names
| Name | Disulergine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.36g/cm3 |
|---|
| Boiling Point | 544.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H24N4O2S |
|---|
| Molecular Weight | 348.46300 |
|---|
| Flash Point | 283.3ºC |
|---|
| Exact Mass | 348.16200 |
|---|
| PSA | 76.82000 |
|---|
| LogP | 2.68590 |
|---|
| Index of Refraction | 1.677 |
|---|
| InChIKey | VUEGYUOUAAVYAS-JGGQBBKZSA-N |
|---|
| SMILES | CN1CC(NS(=O)(=O)N(C)C)CC2c3cccc4[nH]cc(c34)CC21 |
|---|
Synonyms
| N,N-dimethyl-N'-(6-methyl-ergolin-8-yl)-sulfamide |
| Sandoz 29-717 |
| Sulergine |
