Introduction:Basic information about CAS 1178-28-5|Metoserpate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Metoserpate |
|---|
| CAS Number | 1178-28-5 | Molecular Weight | 428.52100 |
|---|
| Density | 1.26g/cm3 | Boiling Point | 566.5ºC at 760mmHg |
|---|
| Molecular Formula | C24H32N2O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 296.4ºC |
|---|
Names
| Name | Metoserpate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.26g/cm3 |
|---|
| Boiling Point | 566.5ºC at 760mmHg |
|---|
| Molecular Formula | C24H32N2O5 |
|---|
| Molecular Weight | 428.52100 |
|---|
| Flash Point | 296.4ºC |
|---|
| Exact Mass | 428.23100 |
|---|
| PSA | 73.02000 |
|---|
| LogP | 2.87260 |
|---|
| Vapour Pressure | 7.46E-13mmHg at 25°C |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | FPGCYQVKNKEGRQ-SXLQGMKLSA-N |
|---|
| SMILES | COC(=O)C1C2CC3c4[nH]c5cc(OC)ccc5c4CCN3CC2CC(OC)C1OC |
|---|
Synonyms
| Methyl O-Methyl-18-epireserp |
| Methyl O-Methyl-18-epi-reserpate |
| O-Methyl-18-epireserpic Acid Methyl Ester |
| Mepiserpate |
| 11,17,18-trimethoxy-yohimbane-16-carboxylic acid methyl ester |
| 2,3,11-trimethoxy-1,2,3,4,4a,5,7,8,13,13b,14,14a-dodecahydroisoquinolino[3,2-a] |
| b-carboline-1-carboxylic acid methyl ester |
| 18-epi-O-Methylreserpic Acid Methyl Ester |
| Methyl-18-epi-O-methyl-reserpat |
| Methyl 18-epi-O-methyl-3-isoreserpate |