Introduction：Basic information about CAS 113759-50-5|Cronidipine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cronidipine |
|---|
| CAS Number | 113759-50-5 | Molecular Weight | 598.04300 |
|---|
| Density | 1.4g/cm3 | Boiling Point | 750.9ºC at 760 mmHg |
|---|
| Molecular Formula | C30H32ClN3O8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 407.9ºC |
|---|
Names
| Name | 5-O-[[8-(4-chlorophenyl)-1,4-dioxa-8-azaspiro[4.5]decan-3-yl]methyl] 3-O-methyl 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4g/cm3 |
|---|
| Boiling Point | 750.9ºC at 760 mmHg |
|---|
| Molecular Formula | C30H32ClN3O8 |
|---|
| Molecular Weight | 598.04300 |
|---|
| Flash Point | 407.9ºC |
|---|
| Exact Mass | 597.18800 |
|---|
| PSA | 132.15000 |
|---|
| LogP | 5.52830 |
|---|
| Vapour Pressure | 1.98E-22mmHg at 25°C |
|---|
| Index of Refraction | 1.636 |
|---|
| InChIKey | CNIJVNPIIHWRRP-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC2COC3(CCN(c4ccc(Cl)cc4)CC3)O2)C1c1cccc([N+](=O)[O-])c1 |
|---|
Synonyms
| Cronidipino [INN-Spanish] |
| Cronidipinum |
| LF 2-0254 |
| Cronidipinum [INN-Latin] |
| Cronidipine |
| UNII-7TXJ9MY5V9 |
| Cronidipino |
