Introduction:Basic information about CAS 150356-67-5|1-bromo-4-methoxy-2-phenylmethoxybenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-bromo-4-methoxy-2-phenylmethoxybenzene |
|---|
| CAS Number | 150356-67-5 | Molecular Weight | 293.15600 |
|---|
| Density | 1.367g/cm3 | Boiling Point | 377.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H13BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166.1ºC |
|---|
Names
| Name | 1-bromo-4-methoxy-2-phenylmethoxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.367g/cm3 |
|---|
| Boiling Point | 377.8ºC at 760mmHg |
|---|
| Molecular Formula | C14H13BrO2 |
|---|
| Molecular Weight | 293.15600 |
|---|
| Flash Point | 166.1ºC |
|---|
| Exact Mass | 292.01000 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.03670 |
|---|
| Vapour Pressure | 1.43E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | GPNMWTHCRMWAFR-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(Br)c(OCc2ccccc2)c1 |
|---|
Safety Information
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1-bromo-4-methoxy-2-(phenylmethoxy)benzene |
| Benzene,1-bromo-4-methoxy-2-(phenylmethoxy) |
| 2-benzyloxy-4-methoxyphenyl bromide |
| 4-bromo-3-benzyloxyanisole |
| 2-(Benzyloxy)-1-bromo-4-methoxybenzene |
| 3-benzyloxy-4-bromoanisole |
| 2-benzyloxy-4-methoxy-1-bromobenzene |