Introduction：Basic information about CAS 404392-70-7|tert-Butyldimethylsilyl N-Phenylbenzimidate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyldimethylsilyl N-Phenylbenzimidate |
|---|
| CAS Number | 404392-70-7 | Molecular Weight | 311.493 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 373.3±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C19H25NOSi | Melting Point | 71ºC |
|---|
| MSDS | / | Flash Point | 179.5±23.2 °C |
|---|
Names
| Name | O-(tert-Butyldimethylsilyl)benzanilide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 373.3±25.0 °C at 760 mmHg |
|---|
| Melting Point | 71ºC |
|---|
| Molecular Formula | C19H25NOSi |
|---|
| Molecular Weight | 311.493 |
|---|
| Flash Point | 179.5±23.2 °C |
|---|
| Exact Mass | 311.170532 |
|---|
| PSA | 21.59000 |
|---|
| LogP | 6.56 |
|---|
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
|---|
| Index of Refraction | 1.502 |
|---|
| InChIKey | CQKWSHDUCPVOAI-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](C)(C)OC(=Nc1ccccc1)c1ccccc1 |
|---|
Safety Information
Synonyms
| Dimethyl(2-methyl-2-propanyl)silyl N-phenylbenzenecarboximidate |
| tert-Butyl(dimethyl)silyl N-phenylbenzenecarboximidoate |
| tert-ButyldiMethylsilyl N-PhenylbenziMidate |
| [tert-butyl(dimethyl)silyl] N-phenylbenzenecarboximidate |
| Benzenecarboximidic acid, N-phenyl-, (1,1-dimethylethyl)dimethylsilyl ester |
