Introduction：Basic information about CAS 42550-72-1|Methyl 2-benzyl-2-cyano-3-phenylpropanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2-benzyl-2-cyano-3-phenylpropanoate |
|---|
| CAS Number | 42550-72-1 | Molecular Weight | 279.33300 |
|---|
| Density | 1.135g/cm3 | Boiling Point | 445.7ºC at 760 mmHg |
|---|
| Molecular Formula | C18H17NO2 | Melting Point | 57-60ºC |
|---|
| MSDS | / | Flash Point | 221ºC |
|---|
Names
| Name | Methyl 2-benzyl-2-cyano-3-phenylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.135g/cm3 |
|---|
| Boiling Point | 445.7ºC at 760 mmHg |
|---|
| Melting Point | 57-60ºC |
|---|
| Molecular Formula | C18H17NO2 |
|---|
| Molecular Weight | 279.33300 |
|---|
| Flash Point | 221ºC |
|---|
| Exact Mass | 279.12600 |
|---|
| PSA | 50.09000 |
|---|
| LogP | 3.15478 |
|---|
| Index of Refraction | 1.568 |
|---|
| InChIKey | DIRZLMLPFWIGLB-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(C#N)(Cc1ccccc1)Cc1ccccc1 |
|---|
Synonyms
| 2-benzyl-2-cyano-3-phenyl-propionic acid methyl ester |
| 2-Benzyl-2-cyan-3-phenyl-propionsaeure-methylester |
| Dibenzylcyanessigsaeuremethylester |
| HMS1446J13 |
| cyano-dibenzylacetic acid methyl ester |
| methyl dibenzyl-cyanoacetate |
| methylbenzylcyanophenylpropanoate |
| methyl 2-benzyl-2-cyano-3-phenylpropionate |
