CAS 1171-47-7|2,2-BIS(4-CARBOXYPHENYL)HEXAFLUOROPROPANE
| Common Name | 2,2-BIS(4-CARBOXYPHENYL)HEXAFLUOROPROPANE | ||
|---|---|---|---|
| CAS Number | 1171-47-7 | Molecular Weight | 392.249 |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 424.4±45.0 °C at 760 mmHg |
| Molecular Formula | C17H10F6O4 | Melting Point | 272-274 °C(lit.) |
| MSDS | ChineseUSA | Flash Point | 210.5±28.7 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | 2,2-bis(4-carboxyphenyl)hexafluoropropane |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 424.4±45.0 °C at 760 mmHg |
| Melting Point | 272-274 °C(lit.) |
| Molecular Formula | C17H10F6O4 |
| Molecular Weight | 392.249 |
| Flash Point | 210.5±28.7 °C |
| Exact Mass | 392.048340 |
| PSA | 74.60000 |
| LogP | 3.64 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | PHQYMDAUTAXXFZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(C(c2ccc(C(=O)O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2917399090 |
Customs
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
Articles4
More Articles| Three lanthanum MOF polymorphs: insights into kinetically and thermodynamically controlled phases. Inorg. Chem. 48(11) , 4707-13, (2009) RPF-4 is a family of polymeric frameworks prepared with rare-earth elements and the versatile ligand 4,4'-(hexafluoroisopropylidene)bis(benzoic acid). We have found that during the synthesis procedure... | |
| Self-assembly of metal-organic coordination polymers constructed from a bent dicarboxylate ligand: diversity of coordination modes, structures, and gas adsorption. Inorg. Chem. 48(23) , 11067-78, (2009) We have synthesized five new metal-organic coordination polymers incorporating the bent ligand H(2)hfipbb [4,4'-(hexafluoroisopropylidene)bis(benzoic acid)] with different transition metal ions and co... | |
| Solvothermal syntheses, structures, and physical properties of four new coordination compounds constructed from a bent dicarboxylate ligand. Dalton Trans. 39(35) , 8240-7, (2010) Four new coordination compounds, namely {[Cd(3)(L)(2)(mu(3)-OH)(2)(H(2)O)] x H(2)O}(n) (1), {Ni(L)(bipy)}(n) (2), {Cu(3)(L)(2)(bipy)(mu(2)-OH)(2)(DMF)(2)}(n) (3), and {Co(2)L(2)(H(2)L)(H(2)O)}(n) (4),... |
Synonyms
| 4,4′-(hexafluoroisopropylidene)bis(benzoic acid) |
| 4,4′-(hexafluoroisopropylidene) bis(benzoic acid) |
| 4,4′-(hexa-fluoroisopropylidene)bis(benzoic acid) |
| 4,4'-(1,1,1,3,3,3-Hexafluoro-2,2-propanediyl)dibenzoic acid |
| Benzoic acid, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- |
| 4-[2-(4-carboxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzoic acid |
| 4,4'-(Hexafluoroisopropylidene)bis(benzoic Acid) |
| 4,4'-(Perfluoropropane-2,2-diyl)dibenzoic acid |
| MFCD00040931 |
| 2,2-Bis(4-carboxyphenyl)hexafluoropropane |
| 4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)dibenzoic acid |
| 4,4′-(hexafluoroisopropylidene)-bis(benzoic acid) |
