Introduction：Basic information about CAS 43129-41-5|1-(3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid |
|---|
| CAS Number | 43129-41-5 | Molecular Weight | 250.29000 |
|---|
| Density | 1.182g/cm3 | Boiling Point | 403.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.5ºC |
|---|
| Symbol |
GHS06 | Signal Word | Danger |
|---|
Names
| Name | 1-(3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid |
|---|
Chemical & Physical Properties
| Density | 1.182g/cm3 |
|---|
| Boiling Point | 403.7ºC at 760 mmHg |
|---|
| Molecular Formula | C14H18O4 |
|---|
| Molecular Weight | 250.29000 |
|---|
| Flash Point | 150.5ºC |
|---|
| Exact Mass | 250.12100 |
|---|
| PSA | 55.76000 |
|---|
| LogP | 2.60020 |
|---|
| Index of Refraction | 1.544 |
|---|
| InChIKey | XKZPEWPCGQOEIS-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C2(C(=O)O)CCCC2)cc1OC |
|---|
Safety Information
| Symbol |
GHS06 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H301-H319 |
|---|
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
|---|
| RIDADR | UN 2811 6.1 / PGIII |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
