Introduction：Basic information about CAS 209912-44-7|methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate |
|---|
| CAS Number | 209912-44-7 | Molecular Weight | 218.20900 |
|---|
| Density | 1.225g/cm3 | Boiling Point | 359.089ºC at 760 mmHg |
|---|
| Molecular Formula | C11H10N2O3 | Melting Point | 160ºC |
|---|
| MSDS | / | Flash Point | 170.971ºC |
|---|
Names
| Name | methyl 4-(3-methyl-1,2,4-oxadiazol-5-yl)benzoate |
|---|
Chemical & Physical Properties
| Density | 1.225g/cm3 |
|---|
| Boiling Point | 359.089ºC at 760 mmHg |
|---|
| Melting Point | 160ºC |
|---|
| Molecular Formula | C11H10N2O3 |
|---|
| Molecular Weight | 218.20900 |
|---|
| Flash Point | 170.971ºC |
|---|
| Exact Mass | 218.06900 |
|---|
| PSA | 65.22000 |
|---|
| LogP | 1.83160 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.54 |
|---|
| InChIKey | PJYMNVKGDLTDJE-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1ccc(-c2nc(C)no2)cc1 |
|---|
