Introduction：Basic information about CAS 7071-12-7|Triethyl 2-chloro-2-phosphonoacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Triethyl 2-chloro-2-phosphonoacetate |
|---|
| CAS Number | 7071-12-7 | Molecular Weight | 258.63600 |
|---|
| Density | 1.21 | Boiling Point | 93-95ºC (0.01 mmHg) |
|---|
| Molecular Formula | C8H16ClO5P | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | >110ºC |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | ethyl 2-chloro-2-diethoxyphosphorylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21 |
|---|
| Boiling Point | 93-95ºC (0.01 mmHg) |
|---|
| Molecular Formula | C8H16ClO5P |
|---|
| Molecular Weight | 258.63600 |
|---|
| Flash Point | >110ºC |
|---|
| Exact Mass | 258.04200 |
|---|
| PSA | 71.64000 |
|---|
| LogP | 2.38050 |
|---|
| Index of Refraction | 1.446 |
|---|
| InChIKey | PCDXCIMROXIFBI-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(Cl)P(=O)(OCC)OCC |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| (EtO)2OPCH(Cl)CO2Et |
| Ethyl 2-chloro-2-(diethoxyphosphoryl)acetate |
| MFCD00192516 |
| Triethyl 2-chloro-2-phosphonoacetate |
| diethyl 1-chloro-1-ethoxycarbonylmethanephosphonate |
| (EtO)2P(O)CH(Cl)CO2Et |
| ethyl 2-chloro-2-(diethylphosphono)acetate |
| chloro-1 carbethoxy-1 methylphosphonate de diethyle |
| (EtO)2(O)PCH(Cl)COOEt |
