Introduction：Basic information about CAS 556-10-5|p-Nitrophenylurea, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | p-Nitrophenylurea |
|---|
| CAS Number | 556-10-5 | Molecular Weight | 181.14900 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 341.2ºC at 760 mmHg |
|---|
| Molecular Formula | C7H7N3O3 | Melting Point | 217 °C |
|---|
| MSDS | / | Flash Point | 160.2ºC |
|---|
Names
| Name | (4-nitrophenyl)urea |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 341.2ºC at 760 mmHg |
|---|
| Melting Point | 217 °C |
|---|
| Molecular Formula | C7H7N3O3 |
|---|
| Molecular Weight | 181.14900 |
|---|
| Flash Point | 160.2ºC |
|---|
| Exact Mass | 181.04900 |
|---|
| PSA | 100.94000 |
|---|
| LogP | 2.38190 |
|---|
| Index of Refraction | 1.68 |
|---|
| InChIKey | LXXTVGKSGJADFU-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)Nc1ccc([N+](=O)[O-])cc1 |
|---|
Synonyms
| p-Nitrophenylurea |
| 4-Nitrophenylurea |
| para-nitrophenylurea |
